C21H20Cl2N4O4 — CID 40794691
N-[(2S)-2-(2,4-dichlorophenyl)pentyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 40794691) has the molecular formula C21H20Cl2N4O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is N-[(2S)-2-(2,4-dichlorophenyl)pentyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(2S)-2-(2,4-dichlorophenyl)pentyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 40794691 |
| Molecular Formula | C21H20Cl2N4O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[(2S)-2-(2,4-dichlorophenyl)pentyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCC[C@H](CNC(=O)Cn1cnc2ccc([N+](=O)[O-])cc2c1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O4/c1-2-3-13(16-6-4-14(22)8-18(16)23)10-24-20(28)11-26-12-25-19-7-5-15(27(30)31)9-17(19)21(26)29/h4-9,12-13H,2-3,10-11H2,1H3,(H,24,28)/t13-/m1/s1 |
| InChIKey | FCBPHWYNGXJQEF-CYBMUJFWSA-N |
| XLogP | 4.31 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|