C15H17N3O3 — CID 40801390
(3R)-3-amino-3-[2-(2-ethoxyphenyl)pyrimidin-5-yl]propanoic acid (PubChem CID 40801390) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3R)-3-amino-3-[2-(2-ethoxyphenyl)pyrimidin-5-yl]propanoic acid.
| Compound Name | (3R)-3-amino-3-[2-(2-ethoxyphenyl)pyrimidin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 40801390 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3R)-3-amino-3-[2-(2-ethoxyphenyl)pyrimidin-5-yl]propanoic acid |
| SMILES | CCOc1ccccc1-c1ncc([C@H](N)CC(=O)O)cn1 |
| InChI | InChI=1S/C15H17N3O3/c1-2-21-13-6-4-3-5-11(13)15-17-8-10(9-18-15)12(16)7-14(19)20/h3-6,8-9,12H,2,7,16H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | CDEXKIBAYIXXTF-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |