C12H13N3O3 — CID 82295719
2-[3-(2-ethoxyphenyl)-1,2,4-triazol-1-yl]acetic acid (PubChem CID 82295719) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-[3-(2-ethoxyphenyl)-1,2,4-triazol-1-yl]acetic acid.
| Compound Name | 2-[3-(2-ethoxyphenyl)-1,2,4-triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 82295719 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-[3-(2-ethoxyphenyl)-1,2,4-triazol-1-yl]acetic acid |
| SMILES | CCOc1ccccc1-c1ncn(CC(=O)O)n1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-18-10-6-4-3-5-9(10)12-13-8-15(14-12)7-11(16)17/h3-6,8H,2,7H2,1H3,(H,16,17) |
| InChIKey | TVYDZHBEGLKZIJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |