C12H13N3O2 — CID 82289099
3-[3-(2-methylphenyl)-1,2,4-triazol-1-yl]propanoic acid (PubChem CID 82289099) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-[3-(2-methylphenyl)-1,2,4-triazol-1-yl]propanoic acid.
| Compound Name | 3-[3-(2-methylphenyl)-1,2,4-triazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 82289099 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-[3-(2-methylphenyl)-1,2,4-triazol-1-yl]propanoic acid |
| SMILES | Cc1ccccc1-c1ncn(CCC(=O)O)n1 |
| InChI | InChI=1S/C12H13N3O2/c1-9-4-2-3-5-10(9)12-13-8-15(14-12)7-6-11(16)17/h2-5,8H,6-7H2,1H3,(H,16,17) |
| InChIKey | LDEGTPOSIZEIPD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |