C16H11BrClNO3S — CID 40803451
(1R,2R)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 40803451) has the molecular formula C16H11BrClNO3S and a molecular weight of 412.69 g/mol. Its IUPAC name is (1R,2R)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione.
| Compound Name | (1R,2R)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 40803451 |
| Molecular Formula | C16H11BrClNO3S |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | (1R,2R)-4-(4-bromophenyl)-2-(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | O=C1C[S@@](=O)[C@H](c2ccc(Cl)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H11BrClNO3S/c17-11-3-7-13(8-4-11)19-14(20)9-23(22)15(16(19)21)10-1-5-12(18)6-2-10/h1-8,15H,9H2/t15-,23-/m1/s1 |
| InChIKey | VTMXCIQKXXSKDD-IQMFZBJNSA-N |
| XLogP | 3.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|