C22H21N5O3S — CID 40811560
N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylacetamide (PubChem CID 40811560) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylacetamide.
| Compound Name | N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40811560 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylacetamide |
| SMILES | CC[C@@]1(C)NC(=O)N(NC(=O)CSc2nnc(-c3ccccc3)c3ccccc23)C1=O |
| InChI | InChI=1S/C22H21N5O3S/c1-3-22(2)20(29)27(21(30)23-22)26-17(28)13-31-19-16-12-8-7-11-15(16)18(24-25-19)14-9-5-4-6-10-14/h4-12H,3,13H2,1-2H3,(H,23,30)(H,26,28)/t22-/m1/s1 |
| InChIKey | SQYDBGIPVGCCEQ-JOCHJYFZSA-N |
| XLogP | 3.14 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|