C13H15ClN4O3S — CID 46693871
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 46693871) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 46693871 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CSc2ncccc2Cl)C1=O |
| InChI | InChI=1S/C13H15ClN4O3S/c1-3-13(2)11(20)18(12(21)16-13)17-9(19)7-22-10-8(14)5-4-6-15-10/h4-6H,3,7H2,1-2H3,(H,16,21)(H,17,19) |
| InChIKey | VBIVBBXEQRLWMR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|