C15H18N4O6S — CID 43032849
[2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate (PubChem CID 43032849) has the molecular formula C15H18N4O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate.
| Compound Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 43032849 |
| Molecular Formula | C15H18N4O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate |
| SMILES | CCC1(C)NC(=O)N(NC(=O)COC(=O)CSc2cccc[n+]2[O-])C1=O |
| InChI | InChI=1S/C15H18N4O6S/c1-3-15(2)13(22)19(14(23)16-15)17-10(20)8-25-12(21)9-26-11-6-4-5-7-18(11)24/h4-7H,3,8-9H2,1-2H3,(H,16,23)(H,17,20) |
| InChIKey | GLSULJFPDHOBIX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|