C16H20N4O7S — CID 16564815
[2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate (PubChem CID 16564815) has the molecular formula C16H20N4O7S and a molecular weight of 412.42 g/mol. Its IUPAC name is [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate.
| Compound Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16564815 |
| Molecular Formula | C16H20N4O7S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
| SMILES | CCC1(C)NC(=O)N(NC(=O)COC(=O)c2cccc(NS(C)(=O)=O)c2)C1=O |
| InChI | InChI=1S/C16H20N4O7S/c1-4-16(2)14(23)20(15(24)17-16)18-12(21)9-27-13(22)10-6-5-7-11(8-10)19-28(3,25)26/h5-8,19H,4,9H2,1-3H3,(H,17,24)(H,18,21) |
| InChIKey | WUMIIOZJCXJYMH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|