C15H18N4O7S — CID 43032985
[2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 4-sulfamoylbenzoate (PubChem CID 43032985) has the molecular formula C15H18N4O7S and a molecular weight of 398.40 g/mol. Its IUPAC name is [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 4-sulfamoylbenzoate.
| Compound Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 43032985 |
| Molecular Formula | C15H18N4O7S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [2-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)amino]-2-oxoethyl] 4-sulfamoylbenzoate |
| SMILES | CCC1(C)NC(=O)N(NC(=O)COC(=O)c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C15H18N4O7S/c1-3-15(2)13(22)19(14(23)17-15)18-11(20)8-26-12(21)9-4-6-10(7-5-9)27(16,24)25/h4-7H,3,8H2,1-2H3,(H,17,23)(H,18,20)(H2,16,24,25) |
| InChIKey | DUVYQASQAYVODV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|