C21H32N4O5S — CID 98387592
N-[(4R)-4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(propylsulfonylamino)benzamide (PubChem CID 98387592) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[(4R)-4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(propylsulfonylamino)benzamide.
| Compound Name | N-[(4R)-4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 98387592 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[(4R)-4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(propylsulfonylamino)benzamide |
| SMILES | CCCCCCC[C@@]1(C)NC(=O)N(NC(=O)c2cccc(NS(=O)(=O)CCC)c2)C1=O |
| InChI | InChI=1S/C21H32N4O5S/c1-4-6-7-8-9-13-21(3)19(27)25(20(28)22-21)23-18(26)16-11-10-12-17(15-16)24-31(29,30)14-5-2/h10-12,15,24H,4-9,13-14H2,1-3H3,(H,22,28)(H,23,26)/t21-/m1/s1 |
| InChIKey | PQTCTRYKNZXOFI-OAQYLSRUSA-N |
| XLogP | 3.15 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|