C15H13FN2O3S — CID 40812348
(1R,6R)-6-[(2-fluoro-4-thiocyanatophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 40812348) has the molecular formula C15H13FN2O3S and a molecular weight of 320.35 g/mol. Its IUPAC name is (1R,6R)-6-[(2-fluoro-4-thiocyanatophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-6-[(2-fluoro-4-thiocyanatophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40812348 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (1R,6R)-6-[(2-fluoro-4-thiocyanatophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | N#CSc1ccc(NC(=O)[C@@H]2CC=CC[C@H]2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H13FN2O3S/c16-12-7-9(22-8-17)5-6-13(12)18-14(19)10-3-1-2-4-11(10)15(20)21/h1-2,5-7,10-11H,3-4H2,(H,18,19)(H,20,21)/t10-,11-/m1/s1 |
| InChIKey | NZPJNGJZLVICLG-GHMZBOCLSA-N |
| XLogP | 3.00 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|