C18H18ClN3O5 — CID 40813223
2-(4-chloro-2,6-dimethylphenoxy)-N-[(4R)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40813223) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-N-[(4R)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-[(4R)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40813223 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-[(4R)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1cc(Cl)cc(C)c1OCC(=O)NN1C(=O)N[C@](C)(c2ccco2)C1=O |
| InChI | InChI=1S/C18H18ClN3O5/c1-10-7-12(19)8-11(2)15(10)27-9-14(23)21-22-16(24)18(3,20-17(22)25)13-5-4-6-26-13/h4-8H,9H2,1-3H3,(H,20,25)(H,21,23)/t18-/m1/s1 |
| InChIKey | ILAAUGHFGMVDQG-GOSISDBHSA-N |
| XLogP | 2.43 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|