C18H19N3O4S — CID 40813349
2-(2,4-dimethylphenyl)sulfanyl-N-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40813349) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfanyl-N-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)sulfanyl-N-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40813349 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfanyl-N-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(SCC(=O)NN2C(=O)N[C@@](C)(c3ccco3)C2=O)c(C)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-11-6-7-13(12(2)9-11)26-10-15(22)20-21-16(23)18(3,19-17(21)24)14-5-4-8-25-14/h4-9H,10H2,1-3H3,(H,19,24)(H,20,22)/t18-/m0/s1 |
| InChIKey | KTBIBWQCPXIADN-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|