C16H10Cl3N5O2 — CID 4081353
N-[(4-nitrophenyl)methylideneamino]-2-(trichloromethyl)quinazolin-4-amine (PubChem CID 4081353) has the molecular formula C16H10Cl3N5O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methylideneamino]-2-(trichloromethyl)quinazolin-4-amine.
| Compound Name | N-[(4-nitrophenyl)methylideneamino]-2-(trichloromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 4081353 |
| Molecular Formula | C16H10Cl3N5O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | N-[(4-nitrophenyl)methylideneamino]-2-(trichloromethyl)quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2nc(C(Cl)(Cl)Cl)nc3ccccc23)cc1 |
| InChI | InChI=1S/C16H10Cl3N5O2/c17-16(18,19)15-21-13-4-2-1-3-12(13)14(22-15)23-20-9-10-5-7-11(8-6-10)24(25)26/h1-9H,(H,21,22,23) |
| InChIKey | PNNCLJLHXYWJOA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|