C16H11N9O2 — CID 25107655
N-[(E)-(4-nitrophenyl)methylideneamino]-6-phenyltetrazolo[1,5-b][1,2,4]triazin-7-amine (PubChem CID 25107655) has the molecular formula C16H11N9O2 and a molecular weight of 361.33 g/mol. Its IUPAC name is N-[(E)-(4-nitrophenyl)methylideneamino]-6-phenyltetrazolo[1,5-b][1,2,4]triazin-7-amine.
| Compound Name | N-[(E)-(4-nitrophenyl)methylideneamino]-6-phenyltetrazolo[1,5-b][1,2,4]triazin-7-amine |
|---|---|
| PubChem CID | 25107655 |
| Molecular Formula | C16H11N9O2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(E)-(4-nitrophenyl)methylideneamino]-6-phenyltetrazolo[1,5-b][1,2,4]triazin-7-amine |
| SMILES | O=[N+]([O-])c1ccc(/C=N/Nc2nc3nnnn3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H11N9O2/c26-25(27)13-8-6-11(7-9-13)10-17-19-15-14(12-4-2-1-3-5-12)21-24-16(18-15)20-22-23-24/h1-10H,(H,18,19,20,23)/b17-10+ |
| InChIKey | KUZCLSZSXNVJCT-LICLKQGHSA-N |
| XLogP | 1.94 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|