C18H13N7O3 — CID 156757072
6-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-8-phenyl-1,7-dihydropurin-2-one (PubChem CID 156757072) has the molecular formula C18H13N7O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 6-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-8-phenyl-1,7-dihydropurin-2-one.
| Compound Name | 6-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-8-phenyl-1,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 156757072 |
| Molecular Formula | C18H13N7O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 6-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-8-phenyl-1,7-dihydropurin-2-one |
| SMILES | O=c1nc2nc(-c3ccccc3)[nH]c2c(NN=Cc2ccc([N+](=O)[O-])cc2)[nH]1 |
| InChI | InChI=1S/C18H13N7O3/c26-18-22-16-14(20-15(21-16)12-4-2-1-3-5-12)17(23-18)24-19-10-11-6-8-13(9-7-11)25(27)28/h1-10H,(H3,20,21,22,23,24,26) |
| InChIKey | GQFYVRARFNYHBZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|