C12H9N7O2S — CID 10781619
6-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,7-dihydropurine-2-thione (PubChem CID 10781619) has the molecular formula C12H9N7O2S and a molecular weight of 315.32 g/mol. Its IUPAC name is 6-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,7-dihydropurine-2-thione.
| Compound Name | 6-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 10781619 |
| Molecular Formula | C12H9N7O2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 6-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,7-dihydropurine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(/C=N/Nc2[nH]c(=S)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C12H9N7O2S/c20-19(21)8-3-1-7(2-4-8)5-15-18-11-9-10(14-6-13-9)16-12(22)17-11/h1-6H,(H3,13,14,16,17,18,22)/b15-5+ |
| InChIKey | AQRSNCISXVEBED-PJQLUOCWSA-N |
| XLogP | 2.37 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|