C23H33N3O7S — CID 40819633
[(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 40819633) has the molecular formula C23H33N3O7S and a molecular weight of 495.60 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 40819633 |
| Molecular Formula | C23H33N3O7S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)O[C@H](C)C(=O)NCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33N3O7S/c1-16-8-9-20(26(29)30)14-21(16)34(31,32)25-12-10-19(11-13-25)23(28)33-17(2)22(27)24-15-18-6-4-3-5-7-18/h8-9,14,17-19H,3-7,10-13,15H2,1-2H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | MRPNGFWAJKFTRI-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|