C16H17F3N4O6S — CID 40822915
[(5R)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 40822915) has the molecular formula C16H17F3N4O6S and a molecular weight of 450.40 g/mol. Its IUPAC name is [(5R)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | [(5R)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 40822915 |
| Molecular Formula | C16H17F3N4O6S |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [(5R)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1)N1N=CC[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O6S/c17-16(18,19)15(25)6-7-20-22(15)14(24)11-4-8-21(9-5-11)30(28,29)13-3-1-2-12(10-13)23(26)27/h1-3,7,10-11,25H,4-6,8-9H2/t15-/m1/s1 |
| InChIKey | WKVCLGZQAGNYML-OAHLLOKOSA-N |
| XLogP | 1.46 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|