C24H24N2O4 — CID 40843286
4-[[[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]amino]methyl]benzoic acid (PubChem CID 40843286) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[[[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 40843286 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[[[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]amino]methyl]benzoic acid |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](NCc1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-16-8-13-21(30-2)20(14-16)26-23(27)22(18-6-4-3-5-7-18)25-15-17-9-11-19(12-10-17)24(28)29/h3-14,22,25H,15H2,1-2H3,(H,26,27)(H,28,29)/t22-/m0/s1 |
| InChIKey | ANXFGAABLYTXOR-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |