C23H30N2O2S2 — CID 40852605
(5Z)-5-[(4-ethylphenyl)methylidene]-3-[4-[(2R)-2-ethylpiperidin-1-yl]-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 40852605) has the molecular formula C23H30N2O2S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is (5Z)-5-[(4-ethylphenyl)methylidene]-3-[4-[(2R)-2-ethylpiperidin-1-yl]-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-ethylphenyl)methylidene]-3-[4-[(2R)-2-ethylpiperidin-1-yl]-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40852605 |
| Molecular Formula | C23H30N2O2S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (5Z)-5-[(4-ethylphenyl)methylidene]-3-[4-[(2R)-2-ethylpiperidin-1-yl]-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/C=C2\SC(=S)N(CCCC(=O)N3CCCC[C@H]3CC)C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O2S2/c1-3-17-10-12-18(13-11-17)16-20-22(27)25(23(28)29-20)15-7-9-21(26)24-14-6-5-8-19(24)4-2/h10-13,16,19H,3-9,14-15H2,1-2H3/b20-16-/t19-/m1/s1 |
| InChIKey | YSPLXGQHFGQFNF-WDULPBOOSA-N |
| XLogP | 5.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|