C23H30N2O4S2 — CID 4758247
5-[(3,4-dimethoxyphenyl)methylidene]-3-[4-(2-ethylpiperidin-1-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4758247) has the molecular formula C23H30N2O4S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methylidene]-3-[4-(2-ethylpiperidin-1-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methylidene]-3-[4-(2-ethylpiperidin-1-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4758247 |
| Molecular Formula | C23H30N2O4S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methylidene]-3-[4-(2-ethylpiperidin-1-yl)-4-oxobutyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCC1CCCCN1C(=O)CCCN1C(=O)C(=Cc2ccc(OC)c(OC)c2)SC1=S |
| InChI | InChI=1S/C23H30N2O4S2/c1-4-17-8-5-6-12-24(17)21(26)9-7-13-25-22(27)20(31-23(25)30)15-16-10-11-18(28-2)19(14-16)29-3/h10-11,14-15,17H,4-9,12-13H2,1-3H3 |
| InChIKey | JTQKOFFVKYGQOG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|