C20H23FN2O2S2 — CID 7655191
(5E)-3-[3-[(2R)-2-ethylpiperidin-1-yl]-3-oxopropyl]-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 7655191) has the molecular formula C20H23FN2O2S2 and a molecular weight of 406.55 g/mol. Its IUPAC name is (5E)-3-[3-[(2R)-2-ethylpiperidin-1-yl]-3-oxopropyl]-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[3-[(2R)-2-ethylpiperidin-1-yl]-3-oxopropyl]-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7655191 |
| Molecular Formula | C20H23FN2O2S2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (5E)-3-[3-[(2R)-2-ethylpiperidin-1-yl]-3-oxopropyl]-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC[C@@H]1CCCCN1C(=O)CCN1C(=O)/C(=C\c2ccccc2F)SC1=S |
| InChI | InChI=1S/C20H23FN2O2S2/c1-2-15-8-5-6-11-22(15)18(24)10-12-23-19(25)17(27-20(23)26)13-14-7-3-4-9-16(14)21/h3-4,7,9,13,15H,2,5-6,8,10-12H2,1H3/b17-13+/t15-/m1/s1 |
| InChIKey | RNZJJMIWQDBLSP-OVGFGYAMSA-N |
| XLogP | 4.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|