C16H13BrFN5O2S — CID 40852945
1-(4-bromo-2-fluorophenyl)-3-[[(5R)-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]thiourea (PubChem CID 40852945) has the molecular formula C16H13BrFN5O2S and a molecular weight of 438.28 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[[(5R)-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[[(5R)-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 40852945 |
| Molecular Formula | C16H13BrFN5O2S |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[[(5R)-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Br)cc1F)[C@H]1CC(c2cccnc2)=NO1 |
| InChI | InChI=1S/C16H13BrFN5O2S/c17-10-3-4-12(11(18)6-10)20-16(26)22-21-15(24)14-7-13(23-25-14)9-2-1-5-19-8-9/h1-6,8,14H,7H2,(H,21,24)(H2,20,22,26)/t14-/m1/s1 |
| InChIKey | HNSIPJTXMNWZQP-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|