C17H21N5O5 — CID 4085510
ethyl 2-[4-[4-(dimethylaminodiazenyl)benzoyl]-2,6-dioxopiperazin-1-yl]acetate (PubChem CID 4085510) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 2-[4-[4-(dimethylaminodiazenyl)benzoyl]-2,6-dioxopiperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-(dimethylaminodiazenyl)benzoyl]-2,6-dioxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 4085510 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 2-[4-[4-(dimethylaminodiazenyl)benzoyl]-2,6-dioxopiperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)CN(C(=O)c2ccc(/N=N/N(C)C)cc2)CC1=O |
| InChI | InChI=1S/C17H21N5O5/c1-4-27-16(25)11-22-14(23)9-21(10-15(22)24)17(26)12-5-7-13(8-6-12)18-19-20(2)3/h5-8H,4,9-11H2,1-3H3/b19-18+ |
| InChIKey | WNXMBWZPPZJLPG-VHEBQXMUSA-N |
| XLogP | 0.62 |
| TPSA | 111.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|