C18H24N4O7 — CID 71449714
dimethyl (2S)-2-[[[(4-ethoxycarbonylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioate (PubChem CID 71449714) has the molecular formula C18H24N4O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is dimethyl (2S)-2-[[[(4-ethoxycarbonylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[[(4-ethoxycarbonylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 71449714 |
| Molecular Formula | C18H24N4O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | dimethyl (2S)-2-[[[(4-ethoxycarbonylphenyl)diazenyl]-methylcarbamoyl]amino]pentanedioate |
| SMILES | CCOC(=O)c1ccc(/N=N/N(C)C(=O)N[C@@H](CCC(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H24N4O7/c1-5-29-16(24)12-6-8-13(9-7-12)20-21-22(2)18(26)19-14(17(25)28-4)10-11-15(23)27-3/h6-9,14H,5,10-11H2,1-4H3,(H,19,26)/b21-20+/t14-/m0/s1 |
| InChIKey | HOBOAOIGBSCGJK-PXKHIBQASA-N |
| XLogP | 2.00 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|