C14H22N8O3 — CID 3130266
ethyl 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetate (PubChem CID 3130266) has the molecular formula C14H22N8O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 3130266 |
| Molecular Formula | C14H22N8O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetate |
| SMILES | [H]/N=C1\N(CC(=O)OCC)C(=O)CN1c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H22N8O3/c1-6-25-10(24)8-21-9(23)7-22(11(21)15)14-17-12(19(2)3)16-13(18-14)20(4)5/h15H,6-8H2,1-5H3/b15-11+ |
| InChIKey | WYVIIXCPFQZXHD-RVDMUPIBSA-N |
| XLogP | -0.85 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|