C12H20N10O2 — CID 171977461
2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetohydrazide (PubChem CID 171977461) has the molecular formula C12H20N10O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetohydrazide.
| Compound Name | 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 171977461 |
| Molecular Formula | C12H20N10O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-2-imino-5-oxoimidazolidin-1-yl]acetohydrazide |
| SMILES | [H]/N=C1\N(CC(=O)NN)C(=O)CN1c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H20N10O2/c1-19(2)10-15-11(20(3)4)17-12(16-10)22-6-8(24)21(9(22)13)5-7(23)18-14/h13H,5-6,14H2,1-4H3,(H,18,23)/b13-9+ |
| InChIKey | LSPBBPWYRFKNQT-UKTHLTGXSA-N |
| XLogP | -2.42 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|