C17H19N3O2 — CID 4087275
N'-[1-(4-aminophenyl)ethenyl]-2-(4-methoxyphenyl)acetohydrazide (PubChem CID 4087275) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N'-[1-(4-aminophenyl)ethenyl]-2-(4-methoxyphenyl)acetohydrazide.
| Compound Name | N'-[1-(4-aminophenyl)ethenyl]-2-(4-methoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 4087275 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N'-[1-(4-aminophenyl)ethenyl]-2-(4-methoxyphenyl)acetohydrazide |
| SMILES | C=C(NNC(=O)Cc1ccc(OC)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-12(14-5-7-15(18)8-6-14)19-20-17(21)11-13-3-9-16(22-2)10-4-13/h3-10,19H,1,11,18H2,2H3,(H,20,21) |
| InChIKey | JGLLIEUXHLASLB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|