C23H16Cl2N2O5 — CID 40875780
(3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 40875780) has the molecular formula C23H16Cl2N2O5 and a molecular weight of 471.30 g/mol. Its IUPAC name is (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 40875780 |
| Molecular Formula | C23H16Cl2N2O5 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)N(Cc2ccc(Cl)cc2)c2ccc(Cl)cc21)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16Cl2N2O5/c24-15-7-5-14(6-8-15)13-26-20-10-9-16(25)11-18(20)23(30,22(26)29)12-21(28)17-3-1-2-4-19(17)27(31)32/h1-11,30H,12-13H2/t23-/m0/s1 |
| InChIKey | APIUUMDSJOGYQO-QHCPKHFHSA-N |
| XLogP | 4.91 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|