C19H15F3N6O — CID 4088101
2-amino-5-oxo-1-(1H-1,2,4-triazol-5-yl)-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 4088101) has the molecular formula C19H15F3N6O and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-amino-5-oxo-1-(1H-1,2,4-triazol-5-yl)-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-1-(1H-1,2,4-triazol-5-yl)-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4088101 |
| Molecular Formula | C19H15F3N6O |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-amino-5-oxo-1-(1H-1,2,4-triazol-5-yl)-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(N)N(c2ncn[nH]2)C2=C(C(=O)CCC2)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H15F3N6O/c20-19(21,22)12-5-2-1-4-10(12)15-11(8-23)17(24)28(18-25-9-26-27-18)13-6-3-7-14(29)16(13)15/h1-2,4-5,9,15H,3,6-7,24H2,(H,25,26,27) |
| InChIKey | VTUQTFOPNZIXPJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |