C23H25NO5S — CID 40884931
ethyl (3R)-3-[(4-methoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate (PubChem CID 40884931) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is ethyl (3R)-3-[(4-methoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate.
| Compound Name | ethyl (3R)-3-[(4-methoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 40884931 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | ethyl (3R)-3-[(4-methoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate |
| SMILES | CCOC(=O)C[C@@H](NS(=O)(=O)c1ccc(OC)c2ccccc12)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO5S/c1-4-29-23(25)15-20(17-11-9-16(2)10-12-17)24-30(26,27)22-14-13-21(28-3)18-7-5-6-8-19(18)22/h5-14,20,24H,4,15H2,1-3H3/t20-/m1/s1 |
| InChIKey | GLNUKVCQRLGURV-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |