C24H27NO5S — CID 40844788
ethyl (3S)-3-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate (PubChem CID 40844788) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is ethyl (3S)-3-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate.
| Compound Name | ethyl (3S)-3-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 40844788 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | ethyl (3S)-3-[(4-ethoxynaphthalen-1-yl)sulfonylamino]-3-(4-methylphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](NS(=O)(=O)c1ccc(OCC)c2ccccc12)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO5S/c1-4-29-22-14-15-23(20-9-7-6-8-19(20)22)31(27,28)25-21(16-24(26)30-5-2)18-12-10-17(3)11-13-18/h6-15,21,25H,4-5,16H2,1-3H3/t21-/m0/s1 |
| InChIKey | YZHXQCRRSHZEGV-NRFANRHFSA-N |
| XLogP | 4.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |