C18H22N2O3S — CID 71852690
N-(1-cyano-2,2-dimethylpropyl)-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 71852690) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-(1-cyano-2,2-dimethylpropyl)-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-(1-cyano-2,2-dimethylpropyl)-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 71852690 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-(1-cyano-2,2-dimethylpropyl)-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(C#N)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C18H22N2O3S/c1-5-23-15-10-11-16(14-9-7-6-8-13(14)15)24(21,22)20-17(12-19)18(2,3)4/h6-11,17,20H,5H2,1-4H3 |
| InChIKey | KQRPFXFVSGHQSZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |