C21H22ClFN4O3 — CID 40891158
N-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 40891158) has the molecular formula C21H22ClFN4O3 and a molecular weight of 432.88 g/mol. Its IUPAC name is N-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 40891158 |
| Molecular Formula | C21H22ClFN4O3 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[(2R)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC[C@@H](c3c(F)cccc3Cl)N(C)C)ccc21 |
| InChI | InChI=1S/C21H22ClFN4O3/c1-4-27-16-9-8-12(10-15(16)25-20(29)21(27)30)19(28)24-11-17(26(2)3)18-13(22)6-5-7-14(18)23/h5-10,17H,4,11H2,1-3H3,(H,24,28)(H,25,29)/t17-/m0/s1 |
| InChIKey | BTPLMGXJZZYTJY-KRWDZBQOSA-N |
| XLogP | 2.53 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|