C20H14ClN3O3S2 — CID 40906772
(5R)-5-(3-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 40906772) has the molecular formula C20H14ClN3O3S2 and a molecular weight of 443.94 g/mol. Its IUPAC name is (5R)-5-(3-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40906772 |
| Molecular Formula | C20H14ClN3O3S2 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | (5R)-5-(3-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CSc1nnc(N2C(=O)C(=O)C(=C(O)c3ccccc3)[C@H]2c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C20H14ClN3O3S2/c1-28-20-23-22-19(29-20)24-15(12-8-5-9-13(21)10-12)14(17(26)18(24)27)16(25)11-6-3-2-4-7-11/h2-10,15,25H,1H3/t15-/m1/s1 |
| InChIKey | WOILIWUZMYATCG-OAHLLOKOSA-N |
| XLogP | 4.54 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|