C28H19Cl2N3O5S2 — CID 98328917
(4E,5S)-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 98328917) has the molecular formula C28H19Cl2N3O5S2 and a molecular weight of 612.52 g/mol. Its IUPAC name is (4E,5S)-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98328917 |
| Molecular Formula | C28H19Cl2N3O5S2 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 611.01 |
| IUPAC Name | (4E,5S)-5-(3-chlorophenyl)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3ccc(Cl)cc3)s2)[C@@H](c2cccc(Cl)c2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H19Cl2N3O5S2/c29-18-7-4-15(5-8-18)14-39-28-32-31-27(40-28)33-23(16-2-1-3-19(30)12-16)22(25(35)26(33)36)24(34)17-6-9-20-21(13-17)38-11-10-37-20/h1-9,12-13,23,34H,10-11,14H2/b24-22+/t23-/m0/s1 |
| InChIKey | BUHRNTXPCZGUPO-AYWGPLOBSA-N |
| XLogP | 6.53 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|