C30H22ClN3O7S2 — CID 99665043
methyl 4-[(2S,3E)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 99665043) has the molecular formula C30H22ClN3O7S2 and a molecular weight of 636.11 g/mol. Its IUPAC name is methyl 4-[(2S,3E)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,3E)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 99665043 |
| Molecular Formula | C30H22ClN3O7S2 |
| Molecular Weight | 636.11 g/mol |
| Exact Mass | 635.06 |
| IUPAC Name | methyl 4-[(2S,3E)-1-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C30H22ClN3O7S2/c1-39-28(38)18-6-4-17(5-7-18)24-23(25(35)19-8-11-21-22(14-19)41-13-12-40-21)26(36)27(37)34(24)29-32-33-30(43-29)42-15-16-2-9-20(31)10-3-16/h2-11,14,24,35H,12-13,15H2,1H3/b25-23+/t24-/m0/s1 |
| InChIKey | RSWKTUBHJPCSQE-NXLSWJSLSA-N |
| XLogP | 5.67 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.11 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|