C28H21N3O6S2 — CID 18813682
(4E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 18813682) has the molecular formula C28H21N3O6S2 and a molecular weight of 559.63 g/mol. Its IUPAC name is (4E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18813682 |
| Molecular Formula | C28H21N3O6S2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | (4E)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3ccccc3)s2)C(c2ccc(O)cc2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H21N3O6S2/c32-19-9-6-17(7-10-19)23-22(24(33)18-8-11-20-21(14-18)37-13-12-36-20)25(34)26(35)31(23)27-29-30-28(39-27)38-15-16-4-2-1-3-5-16/h1-11,14,23,32-33H,12-13,15H2/b24-22+ |
| InChIKey | IZTORKCXJZUMKH-ZNTNEXAZSA-N |
| XLogP | 4.93 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|