C32H23N3O6S2 — CID 6301356
(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-hydroxyphenyl)-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 6301356) has the molecular formula C32H23N3O6S2 and a molecular weight of 609.69 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-hydroxyphenyl)-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-hydroxyphenyl)-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6301356 |
| Molecular Formula | C32H23N3O6S2 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-hydroxyphenyl)-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3cccc4ccccc34)s2)C(c2cccc(O)c2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C32H23N3O6S2/c36-22-9-4-7-19(15-22)27-26(28(37)20-11-12-24-25(16-20)41-14-13-40-24)29(38)30(39)35(27)31-33-34-32(43-31)42-17-21-8-3-6-18-5-1-2-10-23(18)21/h1-12,15-16,27,36-37H,13-14,17H2/b28-26+ |
| InChIKey | IFNSVBLBVOPPAE-BYCLXTJYSA-N |
| XLogP | 6.09 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|