C28H20FN3O6S2 — CID 18815919
(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 18815919) has the molecular formula C28H20FN3O6S2 and a molecular weight of 577.62 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18815919 |
| Molecular Formula | C28H20FN3O6S2 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nnc(SCc3ccc(F)cc3)s2)C(c2ccc(O)cc2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H20FN3O6S2/c29-18-6-1-15(2-7-18)14-39-28-31-30-27(40-28)32-23(16-3-8-19(33)9-4-16)22(25(35)26(32)36)24(34)17-5-10-20-21(13-17)38-12-11-37-20/h1-10,13,23,33-34H,11-12,14H2/b24-22+ |
| InChIKey | NDSYSEZLSGRREA-ZNTNEXAZSA-N |
| XLogP | 5.07 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|