C26H20N2O5 — CID 40907805
(2R)-4-hydroxy-1-(4-methylphenyl)-2-(2-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 40907805) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is (2R)-4-hydroxy-1-(4-methylphenyl)-2-(2-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | (2R)-4-hydroxy-1-(4-methylphenyl)-2-(2-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 40907805 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2R)-4-hydroxy-1-(4-methylphenyl)-2-(2-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | Cc1ccc(N2C(=O)C(O)=C(C(=O)/C=C/c3ccccc3)[C@H]2c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H20N2O5/c1-17-11-14-19(15-12-17)27-24(20-9-5-6-10-21(20)28(32)33)23(25(30)26(27)31)22(29)16-13-18-7-3-2-4-8-18/h2-16,24,30H,1H3/b16-13+/t24-/m1/s1 |
| InChIKey | PRLQUNVZZGGPIB-KROBSHITSA-N |
| XLogP | 5.09 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|