C28H23ClN2O2S2 — CID 40914021
2-[3-(4-chlorophenoxy)propylsulfanyl]-6-methyl-3,5-diphenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 40914021) has the molecular formula C28H23ClN2O2S2 and a molecular weight of 519.09 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)propylsulfanyl]-6-methyl-3,5-diphenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[3-(4-chlorophenoxy)propylsulfanyl]-6-methyl-3,5-diphenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40914021 |
| Molecular Formula | C28H23ClN2O2S2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)propylsulfanyl]-6-methyl-3,5-diphenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(SCCCOc3ccc(Cl)cc3)n(-c3ccccc3)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C28H23ClN2O2S2/c1-19-24(20-9-4-2-5-10-20)25-26(35-19)30-28(31(27(25)32)22-11-6-3-7-12-22)34-18-8-17-33-23-15-13-21(29)14-16-23/h2-7,9-16H,8,17-18H2,1H3 |
| InChIKey | FBRJHAUPTBJFOG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|