C19H17ClN2O4S2 — CID 40921366
(3aS,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(3-chlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 40921366) has the molecular formula C19H17ClN2O4S2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (3aS,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(3-chlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(3-chlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 40921366 |
| Molecular Formula | C19H17ClN2O4S2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | (3aS,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(3-chlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)C[C@@H]2N=C(SCc3cccc(Cl)c3)N(c3ccc4c(c3)OCO4)[C@@H]2C1 |
| InChI | InChI=1S/C19H17ClN2O4S2/c20-13-3-1-2-12(6-13)8-27-19-21-15-9-28(23,24)10-16(15)22(19)14-4-5-17-18(7-14)26-11-25-17/h1-7,15-16H,8-11H2/t15-,16+/m0/s1 |
| InChIKey | QLEKKUCJACDJBC-JKSUJKDBSA-N |
| XLogP | 3.34 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |