C15H18N2O5S2 — CID 40921506
(3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-(2-methoxyethylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 40921506) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-(2-methoxyethylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-(2-methoxyethylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 40921506 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-(2-methoxyethylsulfanyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COCCSC1=N[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18N2O5S2/c1-20-4-5-23-15-16-11-7-24(18,19)8-12(11)17(15)10-2-3-13-14(6-10)22-9-21-13/h2-3,6,11-12H,4-5,7-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | KKTVAEKVCWOBKM-RYUDHWBXSA-N |
| XLogP | 1.14 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|