C19H16Cl2N2O4S2 — CID 41058183
(3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(2,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 41058183) has the molecular formula C19H16Cl2N2O4S2 and a molecular weight of 471.39 g/mol. Its IUPAC name is (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(2,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(2,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 41058183 |
| Molecular Formula | C19H16Cl2N2O4S2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | (3aR,6aR)-3-(1,3-benzodioxol-5-yl)-2-[(2,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)C[C@@H]2N=C(SCc3ccc(Cl)cc3Cl)N(c3ccc4c(c3)OCO4)[C@H]2C1 |
| InChI | InChI=1S/C19H16Cl2N2O4S2/c20-12-2-1-11(14(21)5-12)7-28-19-22-15-8-29(24,25)9-16(15)23(19)13-3-4-17-18(6-13)27-10-26-17/h1-6,15-16H,7-10H2/t15-,16-/m0/s1 |
| InChIKey | OWMFFNSRAJIZRW-HOTGVXAUSA-N |
| XLogP | 4.00 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |