C31H26N2O5 — CID 40929675
[4-[(10R,11S,15R,16S)-12,14-dioxo-13-(2-phenylethyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate (PubChem CID 40929675) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is [4-[(10R,11S,15R,16S)-12,14-dioxo-13-(2-phenylethyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate.
| Compound Name | [4-[(10R,11S,15R,16S)-12,14-dioxo-13-(2-phenylethyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 40929675 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | [4-[(10R,11S,15R,16S)-12,14-dioxo-13-(2-phenylethyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-16-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(CCc4ccccc4)C(=O)[C@@H]3[C@H]3C=Cc4ccccc4N32)cc1 |
| InChI | InChI=1S/C31H26N2O5/c1-19(34)38-23-14-11-22(12-15-23)29(35)28-27-26(25-16-13-21-9-5-6-10-24(21)33(25)28)30(36)32(31(27)37)18-17-20-7-3-2-4-8-20/h2-16,25-28H,17-18H2,1H3/t25-,26-,27-,28+/m1/s1 |
| InChIKey | INPYUMODYYMMGD-HPQIJTKRSA-N |
| XLogP | 3.92 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|