C16H12F3N3O5S — CID 40929738
(4S,5R,6R)-4-hydroxy-6-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 40929738) has the molecular formula C16H12F3N3O5S and a molecular weight of 415.35 g/mol. Its IUPAC name is (4S,5R,6R)-4-hydroxy-6-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5R,6R)-4-hydroxy-6-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 40929738 |
| Molecular Formula | C16H12F3N3O5S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (4S,5R,6R)-4-hydroxy-6-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2[N+](=O)[O-])[C@@H](C(=O)c2cccs2)[C@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C16H12F3N3O5S/c17-16(18,19)15(25)11(13(23)10-6-3-7-28-10)12(20-14(24)21-15)8-4-1-2-5-9(8)22(26)27/h1-7,11-12,25H,(H2,20,21,24)/t11-,12-,15-/m0/s1 |
| InChIKey | XHWWAARUXDSGHW-HUBLWGQQSA-N |
| XLogP | 2.76 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|