C18H16F3N3O5S — CID 6595866
(4S,5S,6R)-1-ethyl-6-hydroxy-4-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 6595866) has the molecular formula C18H16F3N3O5S and a molecular weight of 443.40 g/mol. Its IUPAC name is (4S,5S,6R)-1-ethyl-6-hydroxy-4-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5S,6R)-1-ethyl-6-hydroxy-4-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 6595866 |
| Molecular Formula | C18H16F3N3O5S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (4S,5S,6R)-1-ethyl-6-hydroxy-4-(2-nitrophenyl)-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | CCN1C(=O)N[C@H](c2ccccc2[N+](=O)[O-])[C@H](C(=O)c2cccs2)[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O5S/c1-2-23-16(26)22-14(10-6-3-4-7-11(10)24(28)29)13(17(23,27)18(19,20)21)15(25)12-8-5-9-30-12/h3-9,13-14,27H,2H2,1H3,(H,22,26)/t13-,14-,17-/m1/s1 |
| InChIKey | OGZZUZJQCUFIAQ-CKEIUWERSA-N |
| XLogP | 3.49 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|